C20H24N2O2 — CID 108951133
N'-benzyl-N,N-diethyl-N'-phenylpropanediamide (PubChem CID 108951133) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N'-benzyl-N,N-diethyl-N'-phenylpropanediamide.
| Compound Name | N'-benzyl-N,N-diethyl-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108951133 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N'-benzyl-N,N-diethyl-N'-phenylpropanediamide |
| SMILES | CCN(CC)C(=O)CC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H24N2O2/c1-3-21(4-2)19(23)15-20(24)22(18-13-9-6-10-14-18)16-17-11-7-5-8-12-17/h5-14H,3-4,15-16H2,1-2H3 |
| InChIKey | VOMQMKKZFVQXND-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|