C21H26N2O2 — CID 108951958
N'-benzyl-N-pentyl-N'-phenylpropanediamide (PubChem CID 108951958) has the molecular formula C21H26N2O2 and a molecular weight of 338.45 g/mol. Its IUPAC name is N'-benzyl-N-pentyl-N'-phenylpropanediamide.
| Compound Name | N'-benzyl-N-pentyl-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108951958 |
| Molecular Formula | C21H26N2O2 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.20 |
| IUPAC Name | N'-benzyl-N-pentyl-N'-phenylpropanediamide |
| SMILES | CCCCCNC(=O)CC(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H26N2O2/c1-2-3-10-15-22-20(24)16-21(25)23(19-13-8-5-9-14-19)17-18-11-6-4-7-12-18/h4-9,11-14H,2-3,10,15-17H2,1H3,(H,22,24) |
| InChIKey | FJGLHZSQJWLGKO-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|