C24H24N2O2 — CID 108953721
N'-benzyl-N-(3,5-dimethylphenyl)-N'-phenylpropanediamide (PubChem CID 108953721) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is N'-benzyl-N-(3,5-dimethylphenyl)-N'-phenylpropanediamide.
| Compound Name | N'-benzyl-N-(3,5-dimethylphenyl)-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108953721 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | N'-benzyl-N-(3,5-dimethylphenyl)-N'-phenylpropanediamide |
| SMILES | Cc1cc(C)cc(NC(=O)CC(=O)N(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C24H24N2O2/c1-18-13-19(2)15-21(14-18)25-23(27)16-24(28)26(22-11-7-4-8-12-22)17-20-9-5-3-6-10-20/h3-15H,16-17H2,1-2H3,(H,25,27) |
| InChIKey | HXMFVLLACAWHRO-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|