C20H24N2O2 — CID 108947341
N'-benzyl-N-(3,5-dimethylphenyl)-N'-ethylpropanediamide (PubChem CID 108947341) has the molecular formula C20H24N2O2 and a molecular weight of 324.42 g/mol. Its IUPAC name is N'-benzyl-N-(3,5-dimethylphenyl)-N'-ethylpropanediamide.
| Compound Name | N'-benzyl-N-(3,5-dimethylphenyl)-N'-ethylpropanediamide |
|---|---|
| PubChem CID | 108947341 |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N'-benzyl-N-(3,5-dimethylphenyl)-N'-ethylpropanediamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C20H24N2O2/c1-4-22(14-17-8-6-5-7-9-17)20(24)13-19(23)21-18-11-15(2)10-16(3)12-18/h5-12H,4,13-14H2,1-3H3,(H,21,23) |
| InChIKey | BFDUOHOZNUMVSC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|