C22H28N2O2 — CID 108947354
N'-benzyl-N-(4-tert-butylphenyl)-N'-ethylpropanediamide (PubChem CID 108947354) has the molecular formula C22H28N2O2 and a molecular weight of 352.48 g/mol. Its IUPAC name is N'-benzyl-N-(4-tert-butylphenyl)-N'-ethylpropanediamide.
| Compound Name | N'-benzyl-N-(4-tert-butylphenyl)-N'-ethylpropanediamide |
|---|---|
| PubChem CID | 108947354 |
| Molecular Formula | C22H28N2O2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | N'-benzyl-N-(4-tert-butylphenyl)-N'-ethylpropanediamide |
| SMILES | CCN(Cc1ccccc1)C(=O)CC(=O)Nc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H28N2O2/c1-5-24(16-17-9-7-6-8-10-17)21(26)15-20(25)23-19-13-11-18(12-14-19)22(2,3)4/h6-14H,5,15-16H2,1-4H3,(H,23,25) |
| InChIKey | LHVMJPFMSPCSSA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|