About N-benzyl-N-propylaniline
N-benzyl-N-propylaniline (PubChem CID 14671265) has the molecular formula C16H19N
and a molecular weight of 225.34 g/mol. Its IUPAC name is N-benzyl-N-propylaniline.
Molecular Properties
| Compound Name | N-benzyl-N-propylaniline |
| PubChem CID | 14671265 |
| Molecular Formula | C16H19N |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.15 |
| IUPAC Name | N-benzyl-N-propylaniline |
| SMILES | CCCN(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H19N/c1-2-13-17(16-11-7-4-8-12-16)14-15-9-5-3-6-10-15/h3-12H,2,13-14H2,1H3 |
| InChIKey | WJZNJZWXOFGUFC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-benzyl-N-propylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-propylaniline?
The IUPAC name of N-benzyl-N-propylaniline (CID 14671265) is N-benzyl-N-propylaniline.
What is the SMILES notation for N-benzyl-N-propylaniline?
The canonical SMILES for N-benzyl-N-propylaniline is CCCN(Cc1ccccc1)c1ccccc1.
What is the InChIKey of N-benzyl-N-propylaniline?
The InChIKey is WJZNJZWXOFGUFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N/c1-2-13-17(16-11-7-4-8-12-16)14-15-9-5-3-6-10-15/h3-12H,2,13-14H2,1H3.
What are the key properties of N-benzyl-N-propylaniline?
N-benzyl-N-propylaniline has a molecular weight of 225.34 g/mol, XLogP of 4.10, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-propylaniline is sourced from PubChem (CID 14671265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).