C23H24N2O — CID 102294551
N,N-dibenzyl-2-(N-methylanilino)acetamide (PubChem CID 102294551) has the molecular formula C23H24N2O and a molecular weight of 344.46 g/mol. Its IUPAC name is N,N-dibenzyl-2-(N-methylanilino)acetamide.
| Compound Name | N,N-dibenzyl-2-(N-methylanilino)acetamide |
|---|---|
| PubChem CID | 102294551 |
| Molecular Formula | C23H24N2O |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.19 |
| IUPAC Name | N,N-dibenzyl-2-(N-methylanilino)acetamide |
| SMILES | CN(CC(=O)N(Cc1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H24N2O/c1-24(22-15-9-4-10-16-22)19-23(26)25(17-20-11-5-2-6-12-20)18-21-13-7-3-8-14-21/h2-16H,17-19H2,1H3 |
| InChIKey | UTXRUABNFPZZTA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |