C16H18N2O — CID 11107897
2-amino-N,N-dibenzylacetamide (PubChem CID 11107897) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-amino-N,N-dibenzylacetamide.
| Compound Name | 2-amino-N,N-dibenzylacetamide |
|---|---|
| PubChem CID | 11107897 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-amino-N,N-dibenzylacetamide |
| SMILES | NCC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H18N2O/c17-11-16(19)18(12-14-7-3-1-4-8-14)13-15-9-5-2-6-10-15/h1-10H,11-13,17H2 |
| InChIKey | NOTNDAULKMSUSK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |