C20H26N2O — CID 130162934
3-(aminomethyl)-N,N-dibenzylpentanamide (PubChem CID 130162934) has the molecular formula C20H26N2O and a molecular weight of 310.44 g/mol. Its IUPAC name is 3-(aminomethyl)-N,N-dibenzylpentanamide.
| Compound Name | 3-(aminomethyl)-N,N-dibenzylpentanamide |
|---|---|
| PubChem CID | 130162934 |
| Molecular Formula | C20H26N2O |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.20 |
| IUPAC Name | 3-(aminomethyl)-N,N-dibenzylpentanamide |
| SMILES | CCC(CN)CC(=O)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C20H26N2O/c1-2-17(14-21)13-20(23)22(15-18-9-5-3-6-10-18)16-19-11-7-4-8-12-19/h3-12,17H,2,13-16,21H2,1H3 |
| InChIKey | LQUIGROURLWNJO-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |