About carbamothioic S-acid;dibenzylcarbamothioic S-acid
carbamothioic S-acid;dibenzylcarbamothioic S-acid (PubChem CID 87091037) has the molecular formula C16H18N2O2S2
and a molecular weight of 334.47 g/mol. Its IUPAC name is carbamothioic S-acid;dibenzylcarbamothioic S-acid.
Molecular Properties
| Compound Name | carbamothioic S-acid;dibenzylcarbamothioic S-acid |
| PubChem CID | 87091037 |
| Molecular Formula | C16H18N2O2S2 |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | carbamothioic S-acid;dibenzylcarbamothioic S-acid |
| SMILES | NC(=O)S.O=C(S)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C15H15NOS.CH3NOS/c17-15(18)16(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;2-1(3)4/h1-10H,11-12H2,(H,17,18);(H3,2,3,4) |
| InChIKey | XGAZSUUAWPKATM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze carbamothioic S-acid;dibenzylcarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamothioic S-acid;dibenzylcarbamothioic S-acid?
The IUPAC name of carbamothioic S-acid;dibenzylcarbamothioic S-acid (CID 87091037) is carbamothioic S-acid;dibenzylcarbamothioic S-acid.
What is the SMILES notation for carbamothioic S-acid;dibenzylcarbamothioic S-acid?
The canonical SMILES for carbamothioic S-acid;dibenzylcarbamothioic S-acid is NC(=O)S.O=C(S)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of carbamothioic S-acid;dibenzylcarbamothioic S-acid?
The InChIKey is XGAZSUUAWPKATM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15NOS.CH3NOS/c17-15(18)16(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;2-1(3)4/h1-10H,11-12H2,(H,17,18);(H3,2,3,4).
What are the key properties of carbamothioic S-acid;dibenzylcarbamothioic S-acid?
carbamothioic S-acid;dibenzylcarbamothioic S-acid has a molecular weight of 334.47 g/mol, XLogP of 3.73, 4 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamothioic S-acid;dibenzylcarbamothioic S-acid is sourced from PubChem (CID 87091037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).