About 1-benzyl-1-chlorourea
1-benzyl-1-chlorourea (PubChem CID 23442758) has the molecular formula C8H9ClN2O
and a molecular weight of 184.63 g/mol. Its IUPAC name is 1-benzyl-1-chlorourea.
Molecular Properties
| Compound Name | 1-benzyl-1-chlorourea |
| PubChem CID | 23442758 |
| Molecular Formula | C8H9ClN2O |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.04 |
| IUPAC Name | 1-benzyl-1-chlorourea |
| SMILES | NC(=O)N(Cl)Cc1ccccc1 |
| InChI | InChI=1S/C8H9ClN2O/c9-11(8(10)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12) |
| InChIKey | KGCVZYKAZLNSOH-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-1-chlorourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-1-chlorourea?
The IUPAC name of 1-benzyl-1-chlorourea (CID 23442758) is 1-benzyl-1-chlorourea.
What is the SMILES notation for 1-benzyl-1-chlorourea?
The canonical SMILES for 1-benzyl-1-chlorourea is NC(=O)N(Cl)Cc1ccccc1.
What is the InChIKey of 1-benzyl-1-chlorourea?
The InChIKey is KGCVZYKAZLNSOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9ClN2O/c9-11(8(10)12)6-7-4-2-1-3-5-7/h1-5H,6H2,(H2,10,12).
What are the key properties of 1-benzyl-1-chlorourea?
1-benzyl-1-chlorourea has a molecular weight of 184.63 g/mol, XLogP of 1.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-1-chlorourea is sourced from PubChem (CID 23442758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).