C15H14LiNOSe — CID 102135348
lithium N,N-dibenzylcarbamoselenoate (PubChem CID 102135348) has the molecular formula C15H14LiNOSe and a molecular weight of 310.18 g/mol. Its IUPAC name is lithium N,N-dibenzylcarbamoselenoate.
| Compound Name | lithium N,N-dibenzylcarbamoselenoate |
|---|---|
| PubChem CID | 102135348 |
| Molecular Formula | C15H14LiNOSe |
| Molecular Weight | 310.18 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | lithium N,N-dibenzylcarbamoselenoate |
| SMILES | O=C([Se-])N(Cc1ccccc1)Cc1ccccc1.[Li+] |
| InChI | InChI=1S/C15H15NOSe.Li/c17-15(18)16(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;/h1-10H,11-12H2,(H,17,18);/q;+1/p-1 |
| InChIKey | LPHWDUWXUDTQTQ-UHFFFAOYSA-M |
| XLogP | -0.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.18 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|