C32H54N3O2S2+ — CID 175257220
carbamothioic S-acid;dibenzylcarbamothioic S-acid;tetrabutylazanium (PubChem CID 175257220) has the molecular formula C32H54N3O2S2+ and a molecular weight of 576.94 g/mol. Its IUPAC name is carbamothioic S-acid;dibenzylcarbamothioic S-acid;tetrabutylazanium.
| Compound Name | carbamothioic S-acid;dibenzylcarbamothioic S-acid;tetrabutylazanium |
|---|---|
| PubChem CID | 175257220 |
| Molecular Formula | C32H54N3O2S2+ |
| Molecular Weight | 576.94 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | carbamothioic S-acid;dibenzylcarbamothioic S-acid;tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NC(=O)S.O=C(S)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H36N.C15H15NOS.CH3NOS/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;17-15(18)16(11-13-7-3-1-4-8-13)12-14-9-5-2-6-10-14;2-1(3)4/h5-16H2,1-4H3;1-10H,11-12H2,(H,17,18);(H3,2,3,4)/q+1;; |
| InChIKey | ZLTRERZZPZAYTN-UHFFFAOYSA-N |
| XLogP | 8.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.94 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|