About bis(O-benzyl carbamothioate);tetrabutylazanium
bis(O-benzyl carbamothioate);tetrabutylazanium (PubChem CID 175257170) has the molecular formula C32H54N3O2S2+
and a molecular weight of 576.94 g/mol. Its IUPAC name is bis(O-benzyl carbamothioate);tetrabutylazanium.
Molecular Properties
| Compound Name | bis(O-benzyl carbamothioate);tetrabutylazanium |
| PubChem CID | 175257170 |
| Molecular Formula | C32H54N3O2S2+ |
| Molecular Weight | 576.94 g/mol |
| Exact Mass | 576.37 |
| IUPAC Name | bis(O-benzyl carbamothioate);tetrabutylazanium |
| SMILES | CCCC[N+](CCCC)(CCCC)CCCC.NC(=S)OCc1ccccc1.NC(=S)OCc1ccccc1 |
| InChI | InChI=1S/C16H36N.2C8H9NOS/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*9-8(11)10-6-7-4-2-1-3-5-7/h5-16H2,1-4H3;2*1-5H,6H2,(H2,9,11)/q+1;; |
| InChIKey | GUQKZSCXTSWBDX-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 576.94 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze bis(O-benzyl carbamothioate);tetrabutylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(O-benzyl carbamothioate);tetrabutylazanium?
The IUPAC name of bis(O-benzyl carbamothioate);tetrabutylazanium (CID 175257170) is bis(O-benzyl carbamothioate);tetrabutylazanium.
What is the SMILES notation for bis(O-benzyl carbamothioate);tetrabutylazanium?
The canonical SMILES for bis(O-benzyl carbamothioate);tetrabutylazanium is CCCC[N+](CCCC)(CCCC)CCCC.NC(=S)OCc1ccccc1.NC(=S)OCc1ccccc1.
What is the InChIKey of bis(O-benzyl carbamothioate);tetrabutylazanium?
The InChIKey is GUQKZSCXTSWBDX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H36N.2C8H9NOS/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;2*9-8(11)10-6-7-4-2-1-3-5-7/h5-16H2,1-4H3;2*1-5H,6H2,(H2,9,11)/q+1;;.
What are the key properties of bis(O-benzyl carbamothioate);tetrabutylazanium?
bis(O-benzyl carbamothioate);tetrabutylazanium has a molecular weight of 576.94 g/mol, XLogP of 7.90, 16 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(O-benzyl carbamothioate);tetrabutylazanium is sourced from PubChem (CID 175257170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).