About benzyl(tributyl)azanium;bromide;hydrate
benzyl(tributyl)azanium;bromide;hydrate (PubChem CID 156632314) has the molecular formula C19H36BrNO
and a molecular weight of 374.41 g/mol. Its IUPAC name is benzyl(tributyl)azanium;bromide;hydrate.
Molecular Properties
| Compound Name | benzyl(tributyl)azanium;bromide;hydrate |
| PubChem CID | 156632314 |
| Molecular Formula | C19H36BrNO |
| Molecular Weight | 374.41 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | benzyl(tributyl)azanium;bromide;hydrate |
| SMILES | CCCC[N+](CCCC)(CCCC)Cc1ccccc1.O.[Br-] |
| InChI | InChI=1S/C19H34N.BrH.H2O/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;;/h10-14H,4-9,15-18H2,1-3H3;1H;1H2/q+1;;/p-1 |
| InChIKey | FSXJKOIKPJCDMA-UHFFFAOYSA-M |
| XLogP | 1.58 |
| TPSA | 31.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.41 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl(tributyl)azanium;bromide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl(tributyl)azanium;bromide;hydrate?
The IUPAC name of benzyl(tributyl)azanium;bromide;hydrate (CID 156632314) is benzyl(tributyl)azanium;bromide;hydrate.
What is the SMILES notation for benzyl(tributyl)azanium;bromide;hydrate?
The canonical SMILES for benzyl(tributyl)azanium;bromide;hydrate is CCCC[N+](CCCC)(CCCC)Cc1ccccc1.O.[Br-].
What is the InChIKey of benzyl(tributyl)azanium;bromide;hydrate?
The InChIKey is FSXJKOIKPJCDMA-UHFFFAOYSA-M. The full InChI is InChI=1S/C19H34N.BrH.H2O/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;;/h10-14H,4-9,15-18H2,1-3H3;1H;1H2/q+1;;/p-1.
What are the key properties of benzyl(tributyl)azanium;bromide;hydrate?
benzyl(tributyl)azanium;bromide;hydrate has a molecular weight of 374.41 g/mol, XLogP of 1.58, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl(tributyl)azanium;bromide;hydrate is sourced from PubChem (CID 156632314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).