About dibenzyl(dihexyl)azanium bromide
dibenzyl(dihexyl)azanium bromide (PubChem CID 87778689) has the molecular formula C26H40BrN
and a molecular weight of 446.52 g/mol. Its IUPAC name is dibenzyl(dihexyl)azanium bromide.
Molecular Properties
| Compound Name | dibenzyl(dihexyl)azanium bromide |
| PubChem CID | 87778689 |
| Molecular Formula | C26H40BrN |
| Molecular Weight | 446.52 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | dibenzyl(dihexyl)azanium bromide |
| SMILES | CCCCCC[N+](CCCCCC)(Cc1ccccc1)Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C26H40N.BrH/c1-3-5-7-15-21-27(22-16-8-6-4-2,23-25-17-11-9-12-18-25)24-26-19-13-10-14-20-26;/h9-14,17-20H,3-8,15-16,21-24H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | YRCSORPQPCULJU-UHFFFAOYSA-M |
| XLogP | 4.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.52 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl(dihexyl)azanium bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl(dihexyl)azanium bromide?
The IUPAC name of dibenzyl(dihexyl)azanium bromide (CID 87778689) is dibenzyl(dihexyl)azanium bromide.
What is the SMILES notation for dibenzyl(dihexyl)azanium bromide?
The canonical SMILES for dibenzyl(dihexyl)azanium bromide is CCCCCC[N+](CCCCCC)(Cc1ccccc1)Cc1ccccc1.[Br-].
What is the InChIKey of dibenzyl(dihexyl)azanium bromide?
The InChIKey is YRCSORPQPCULJU-UHFFFAOYSA-M. The full InChI is InChI=1S/C26H40N.BrH/c1-3-5-7-15-21-27(22-16-8-6-4-2,23-25-17-11-9-12-18-25)24-26-19-13-10-14-20-26;/h9-14,17-20H,3-8,15-16,21-24H2,1-2H3;1H/q+1;/p-1.
What are the key properties of dibenzyl(dihexyl)azanium bromide?
dibenzyl(dihexyl)azanium bromide has a molecular weight of 446.52 g/mol, XLogP of 4.37, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl(dihexyl)azanium bromide is sourced from PubChem (CID 87778689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).