About tribenzyl(heptyl)azanium iodide
tribenzyl(heptyl)azanium iodide (PubChem CID 87777653) has the molecular formula C28H36IN
and a molecular weight of 513.51 g/mol. Its IUPAC name is tribenzyl(heptyl)azanium iodide.
Molecular Properties
| Compound Name | tribenzyl(heptyl)azanium iodide |
| PubChem CID | 87777653 |
| Molecular Formula | C28H36IN |
| Molecular Weight | 513.51 g/mol |
| Exact Mass | 513.19 |
| IUPAC Name | tribenzyl(heptyl)azanium iodide |
| SMILES | CCCCCCC[N+](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1.[I-] |
| InChI | InChI=1S/C28H36N.HI/c1-2-3-4-5-15-22-29(23-26-16-9-6-10-17-26,24-27-18-11-7-12-19-27)25-28-20-13-8-14-21-28;/h6-14,16-21H,2-5,15,22-25H2,1H3;1H/q+1;/p-1 |
| InChIKey | KVEWSZQYYUUVIF-UHFFFAOYSA-M |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze tribenzyl(heptyl)azanium iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tribenzyl(heptyl)azanium iodide?
The IUPAC name of tribenzyl(heptyl)azanium iodide (CID 87777653) is tribenzyl(heptyl)azanium iodide.
What is the SMILES notation for tribenzyl(heptyl)azanium iodide?
The canonical SMILES for tribenzyl(heptyl)azanium iodide is CCCCCCC[N+](Cc1ccccc1)(Cc1ccccc1)Cc1ccccc1.[I-].
What is the InChIKey of tribenzyl(heptyl)azanium iodide?
The InChIKey is KVEWSZQYYUUVIF-UHFFFAOYSA-M. The full InChI is InChI=1S/C28H36N.HI/c1-2-3-4-5-15-22-29(23-26-16-9-6-10-17-26,24-27-18-11-7-12-19-27)25-28-20-13-8-14-21-28;/h6-14,16-21H,2-5,15,22-25H2,1H3;1H/q+1;/p-1.
What are the key properties of tribenzyl(heptyl)azanium iodide?
tribenzyl(heptyl)azanium iodide has a molecular weight of 513.51 g/mol, XLogP of 4.38, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tribenzyl(heptyl)azanium iodide is sourced from PubChem (CID 87777653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).