C21H39NO3S — CID 87092693
benzyl(tributyl)azanium;ethanesulfonate (PubChem CID 87092693) has the molecular formula C21H39NO3S and a molecular weight of 385.61 g/mol. Its IUPAC name is benzyl(tributyl)azanium;ethanesulfonate.
| Compound Name | benzyl(tributyl)azanium;ethanesulfonate |
|---|---|
| PubChem CID | 87092693 |
| Molecular Formula | C21H39NO3S |
| Molecular Weight | 385.61 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | benzyl(tributyl)azanium;ethanesulfonate |
| SMILES | CCCC[N+](CCCC)(CCCC)Cc1ccccc1.CCS(=O)(=O)[O-] |
| InChI | InChI=1S/C19H34N.C2H6O3S/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;1-2-6(3,4)5/h10-14H,4-9,15-18H2,1-3H3;2H2,1H3,(H,3,4,5)/q+1;/p-1 |
| InChIKey | KUBZCZWNLVDEIT-UHFFFAOYSA-M |
| XLogP | 4.96 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.61 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|