C29H41NO4S — CID 19834289
benzyl(tributyl)azanium;2-hydroxynaphthalene-1-sulfonate (PubChem CID 19834289) has the molecular formula C29H41NO4S and a molecular weight of 499.72 g/mol. Its IUPAC name is benzyl(tributyl)azanium;2-hydroxynaphthalene-1-sulfonate.
| Compound Name | benzyl(tributyl)azanium;2-hydroxynaphthalene-1-sulfonate |
|---|---|
| PubChem CID | 19834289 |
| Molecular Formula | C29H41NO4S |
| Molecular Weight | 499.72 g/mol |
| Exact Mass | 499.28 |
| IUPAC Name | benzyl(tributyl)azanium;2-hydroxynaphthalene-1-sulfonate |
| SMILES | CCCC[N+](CCCC)(CCCC)Cc1ccccc1.O=S(=O)([O-])c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C19H34N.C10H8O4S/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;11-9-6-5-7-3-1-2-4-8(7)10(9)15(12,13)14/h10-14H,4-9,15-18H2,1-3H3;1-6,11H,(H,12,13,14)/q+1;/p-1 |
| InChIKey | LJFVQYQPXJBINN-UHFFFAOYSA-M |
| XLogP | 6.85 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.72 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|