C26H41NO3S — CID 87092683
benzyl(tributyl)azanium;4-methylbenzenesulfonate (PubChem CID 87092683) has the molecular formula C26H41NO3S and a molecular weight of 447.69 g/mol. Its IUPAC name is benzyl(tributyl)azanium;4-methylbenzenesulfonate.
| Compound Name | benzyl(tributyl)azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87092683 |
| Molecular Formula | C26H41NO3S |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | benzyl(tributyl)azanium;4-methylbenzenesulfonate |
| SMILES | CCCC[N+](CCCC)(CCCC)Cc1ccccc1.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C19H34N.C7H8O3S/c1-4-7-15-20(16-8-5-2,17-9-6-3)18-19-13-11-10-12-14-19;1-6-2-4-7(5-3-6)11(8,9)10/h10-14H,4-9,15-18H2,1-3H3;2-5H,1H3,(H,8,9,10)/q+1;/p-1 |
| InChIKey | ORJRLMZGNGNLLG-UHFFFAOYSA-M |
| XLogP | 6.30 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|