C22H19NOSe — CID 122364296
N,N-dibenzyl-2-oxo-2-phenylethaneselenoamide (PubChem CID 122364296) has the molecular formula C22H19NOSe and a molecular weight of 392.36 g/mol. Its IUPAC name is N,N-dibenzyl-2-oxo-2-phenylethaneselenoamide.
| Compound Name | N,N-dibenzyl-2-oxo-2-phenylethaneselenoamide |
|---|---|
| PubChem CID | 122364296 |
| Molecular Formula | C22H19NOSe |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | N,N-dibenzyl-2-oxo-2-phenylethaneselenoamide |
| SMILES | O=C(C(=[Se])N(Cc1ccccc1)Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H19NOSe/c24-21(20-14-8-3-9-15-20)22(25)23(16-18-10-4-1-5-11-18)17-19-12-6-2-7-13-19/h1-15H,16-17H2 |
| InChIKey | GWEMDWQZNVJUQA-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|