C23H27N2O+ — CID 123280628
2-[benzyl-(1-methyl-1,2-dihydroinden-2-ylium-5-yl)amino]-N,N-diethylacetamide (PubChem CID 123280628) has the molecular formula C23H27N2O+ and a molecular weight of 347.48 g/mol. Its IUPAC name is 2-[benzyl-(1-methyl-1,2-dihydroinden-2-ylium-5-yl)amino]-N,N-diethylacetamide.
| Compound Name | 2-[benzyl-(1-methyl-1,2-dihydroinden-2-ylium-5-yl)amino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 123280628 |
| Molecular Formula | C23H27N2O+ |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[benzyl-(1-methyl-1,2-dihydroinden-2-ylium-5-yl)amino]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)CN(Cc1ccccc1)c1ccc2c(c1)C=[C+]C2C |
| InChI | InChI=1S/C23H27N2O/c1-4-24(5-2)23(26)17-25(16-19-9-7-6-8-10-19)21-13-14-22-18(3)11-12-20(22)15-21/h6-10,12-15,18H,4-5,16-17H2,1-3H3/q+1 |
| InChIKey | AECMYHJYWQVRGY-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|