C19H22N2O2 — CID 172997394
N-ethyl-N-methyl-N',N'-diphenylbutanediamide (PubChem CID 172997394) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-ethyl-N-methyl-N',N'-diphenylbutanediamide.
| Compound Name | N-ethyl-N-methyl-N',N'-diphenylbutanediamide |
|---|---|
| PubChem CID | 172997394 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-ethyl-N-methyl-N',N'-diphenylbutanediamide |
| SMILES | CCN(C)C(=O)CCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O2/c1-3-20(2)18(22)14-15-19(23)21(16-10-6-4-7-11-16)17-12-8-5-9-13-17/h4-13H,3,14-15H2,1-2H3 |
| InChIKey | CLQRUGSGWDXBNU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |