C19H21N3O3 — CID 5165535
4-oxo-N,N-diphenyl-4-(2-propanoylhydrazinyl)butanamide (PubChem CID 5165535) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-oxo-N,N-diphenyl-4-(2-propanoylhydrazinyl)butanamide.
| Compound Name | 4-oxo-N,N-diphenyl-4-(2-propanoylhydrazinyl)butanamide |
|---|---|
| PubChem CID | 5165535 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-oxo-N,N-diphenyl-4-(2-propanoylhydrazinyl)butanamide |
| SMILES | CCC(=O)NNC(=O)CCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H21N3O3/c1-2-17(23)20-21-18(24)13-14-19(25)22(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12H,2,13-14H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | KETKJOJFUVYTDR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|