C19H22N2O3 — CID 3996534
N-(2-methoxyethyl)-N',N'-diphenylbutanediamide (PubChem CID 3996534) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N',N'-diphenylbutanediamide.
| Compound Name | N-(2-methoxyethyl)-N',N'-diphenylbutanediamide |
|---|---|
| PubChem CID | 3996534 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N-(2-methoxyethyl)-N',N'-diphenylbutanediamide |
| SMILES | COCCNC(=O)CCC(=O)N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-24-15-14-20-18(22)12-13-19(23)21(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11H,12-15H2,1H3,(H,20,22) |
| InChIKey | UCUAUNOOGZFDFS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|