About CID 159685847
CID 159685847 (PubChem CID 159685847) has the molecular formula C16H15NNaO2
and a molecular weight of 276.29 g/mol.
Molecular Properties
| Compound Name | CID 159685847 |
| PubChem CID | 159685847 |
| Molecular Formula | C16H15NNaO2 |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | — |
| SMILES | CC(=O)CC(=O)N(c1ccccc1)c1ccccc1.[Na] |
| InChI | InChI=1S/C16H15NO2.Na/c1-13(18)12-16(19)17(14-8-4-2-5-9-14)15-10-6-3-7-11-15;/h2-11H,12H2,1H3; |
| InChIKey | MVTZOPBOXKJAJT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze CID 159685847 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159685847?
The IUPAC name of CID 159685847 (CID 159685847) is not available.
What is the SMILES notation for CID 159685847?
The canonical SMILES for CID 159685847 is CC(=O)CC(=O)N(c1ccccc1)c1ccccc1.[Na].
What is the InChIKey of CID 159685847?
The InChIKey is MVTZOPBOXKJAJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15NO2.Na/c1-13(18)12-16(19)17(14-8-4-2-5-9-14)15-10-6-3-7-11-15;/h2-11H,12H2,1H3;.
What are the key properties of CID 159685847?
CID 159685847 has a molecular weight of 276.29 g/mol, XLogP of 2.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159685847 is sourced from PubChem (CID 159685847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).