C22H23F4NO2 — CID 166763737
3-cyclohexyl-N-(3-fluorophenyl)-N-[3-(trifluoromethoxy)phenyl]propanamide (PubChem CID 166763737) has the molecular formula C22H23F4NO2 and a molecular weight of 409.42 g/mol. Its IUPAC name is 3-cyclohexyl-N-(3-fluorophenyl)-N-[3-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-cyclohexyl-N-(3-fluorophenyl)-N-[3-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 166763737 |
| Molecular Formula | C22H23F4NO2 |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 3-cyclohexyl-N-(3-fluorophenyl)-N-[3-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCC1CCCCC1)N(c1cccc(F)c1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C22H23F4NO2/c23-17-8-4-9-18(14-17)27(21(28)13-12-16-6-2-1-3-7-16)19-10-5-11-20(15-19)29-22(24,25)26/h4-5,8-11,14-16H,1-3,6-7,12-13H2 |
| InChIKey | JBEKIEGIEFATSO-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |