C20H30F3NO2 — CID 71106762
N-nonan-5-yl-N-[3-(trifluoromethoxy)phenyl]butanamide (PubChem CID 71106762) has the molecular formula C20H30F3NO2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-nonan-5-yl-N-[3-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | N-nonan-5-yl-N-[3-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 71106762 |
| Molecular Formula | C20H30F3NO2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | N-nonan-5-yl-N-[3-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CCCCC(CCCC)N(C(=O)CCC)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C20H30F3NO2/c1-4-7-11-16(12-8-5-2)24(19(25)10-6-3)17-13-9-14-18(15-17)26-20(21,22)23/h9,13-16H,4-8,10-12H2,1-3H3 |
| InChIKey | YYDDVWRTQRESOU-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |