C17H24F3NO2 — CID 18736042
N-butyl-3,3-dimethyl-N-[3-(trifluoromethoxy)phenyl]butanamide (PubChem CID 18736042) has the molecular formula C17H24F3NO2 and a molecular weight of 331.38 g/mol. Its IUPAC name is N-butyl-3,3-dimethyl-N-[3-(trifluoromethoxy)phenyl]butanamide.
| Compound Name | N-butyl-3,3-dimethyl-N-[3-(trifluoromethoxy)phenyl]butanamide |
|---|---|
| PubChem CID | 18736042 |
| Molecular Formula | C17H24F3NO2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | N-butyl-3,3-dimethyl-N-[3-(trifluoromethoxy)phenyl]butanamide |
| SMILES | CCCCN(C(=O)CC(C)(C)C)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C17H24F3NO2/c1-5-6-10-21(15(22)12-16(2,3)4)13-8-7-9-14(11-13)23-17(18,19)20/h7-9,11H,5-6,10,12H2,1-4H3 |
| InChIKey | BOCBTJBOZDDTMW-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |