C15H19F3N2O4 — CID 19001931
tert-butyl 2-[N-(2-aminoacetyl)-3-(trifluoromethoxy)anilino]acetate (PubChem CID 19001931) has the molecular formula C15H19F3N2O4 and a molecular weight of 348.32 g/mol. Its IUPAC name is tert-butyl 2-[N-(2-aminoacetyl)-3-(trifluoromethoxy)anilino]acetate.
| Compound Name | tert-butyl 2-[N-(2-aminoacetyl)-3-(trifluoromethoxy)anilino]acetate |
|---|---|
| PubChem CID | 19001931 |
| Molecular Formula | C15H19F3N2O4 |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | tert-butyl 2-[N-(2-aminoacetyl)-3-(trifluoromethoxy)anilino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(C(=O)CN)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C15H19F3N2O4/c1-14(2,3)24-13(22)9-20(12(21)8-19)10-5-4-6-11(7-10)23-15(16,17)18/h4-7H,8-9,19H2,1-3H3 |
| InChIKey | QYPWTJTTWZTNSQ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |