C12H12ClF3N2OS — CID 21480066
1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethoxy)phenyl]thiourea (PubChem CID 21480066) has the molecular formula C12H12ClF3N2OS and a molecular weight of 324.76 g/mol. Its IUPAC name is 1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethoxy)phenyl]thiourea.
| Compound Name | 1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethoxy)phenyl]thiourea |
|---|---|
| PubChem CID | 21480066 |
| Molecular Formula | C12H12ClF3N2OS |
| Molecular Weight | 324.76 g/mol |
| Exact Mass | 324.03 |
| IUPAC Name | 1-[(Z)-2-chlorobut-2-enyl]-1-[3-(trifluoromethoxy)phenyl]thiourea |
| SMILES | C/C=C(\Cl)CN(C(N)=S)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C12H12ClF3N2OS/c1-2-8(13)7-18(11(17)20)9-4-3-5-10(6-9)19-12(14,15)16/h2-6H,7H2,1H3,(H2,17,20)/b8-2- |
| InChIKey | FSMNZKZQOVFILA-WAPJZHGLSA-N |
| XLogP | 3.78 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.76 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|