C20H21F4NO5S — CID 68618549
tert-butyl 2-[3-fluoro-N-methylsulfonyl-4-[3-(trifluoromethoxy)phenyl]anilino]acetate (PubChem CID 68618549) has the molecular formula C20H21F4NO5S and a molecular weight of 463.45 g/mol. Its IUPAC name is tert-butyl 2-[3-fluoro-N-methylsulfonyl-4-[3-(trifluoromethoxy)phenyl]anilino]acetate.
| Compound Name | tert-butyl 2-[3-fluoro-N-methylsulfonyl-4-[3-(trifluoromethoxy)phenyl]anilino]acetate |
|---|---|
| PubChem CID | 68618549 |
| Molecular Formula | C20H21F4NO5S |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | tert-butyl 2-[3-fluoro-N-methylsulfonyl-4-[3-(trifluoromethoxy)phenyl]anilino]acetate |
| SMILES | CC(C)(C)OC(=O)CN(c1ccc(-c2cccc(OC(F)(F)F)c2)c(F)c1)S(C)(=O)=O |
| InChI | InChI=1S/C20H21F4NO5S/c1-19(2,3)30-18(26)12-25(31(4,27)28)14-8-9-16(17(21)11-14)13-6-5-7-15(10-13)29-20(22,23)24/h5-11H,12H2,1-4H3 |
| InChIKey | NYSCGJDHEFNNIQ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |