C16H24BrNO — CID 18735896
N-(3-bromophenyl)-N-butyl-3,3-dimethylbutanamide (PubChem CID 18735896) has the molecular formula C16H24BrNO and a molecular weight of 326.28 g/mol. Its IUPAC name is N-(3-bromophenyl)-N-butyl-3,3-dimethylbutanamide.
| Compound Name | N-(3-bromophenyl)-N-butyl-3,3-dimethylbutanamide |
|---|---|
| PubChem CID | 18735896 |
| Molecular Formula | C16H24BrNO |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(3-bromophenyl)-N-butyl-3,3-dimethylbutanamide |
| SMILES | CCCCN(C(=O)CC(C)(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H24BrNO/c1-5-6-10-18(15(19)12-16(2,3)4)14-9-7-8-13(17)11-14/h7-9,11H,5-6,10,12H2,1-4H3 |
| InChIKey | XWUPOUNNNPQCFH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |