C14H18F3NO2 — CID 118576354
N-[[3-(trifluoromethoxy)phenyl]methyl]hexanamide (PubChem CID 118576354) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[[3-(trifluoromethoxy)phenyl]methyl]hexanamide.
| Compound Name | N-[[3-(trifluoromethoxy)phenyl]methyl]hexanamide |
|---|---|
| PubChem CID | 118576354 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | N-[[3-(trifluoromethoxy)phenyl]methyl]hexanamide |
| SMILES | CCCCCC(=O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C14H18F3NO2/c1-2-3-4-8-13(19)18-10-11-6-5-7-12(9-11)20-14(15,16)17/h5-7,9H,2-4,8,10H2,1H3,(H,18,19) |
| InChIKey | XANGSTVHOHKJLG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|