C15H15F3N2O2 — CID 29182663
2-(1-methylpyrrol-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 29182663) has the molecular formula C15H15F3N2O2 and a molecular weight of 312.29 g/mol. Its IUPAC name is 2-(1-methylpyrrol-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(1-methylpyrrol-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 29182663 |
| Molecular Formula | C15H15F3N2O2 |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 2-(1-methylpyrrol-3-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | Cn1ccc(CC(=O)NCc2cccc(OC(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H15F3N2O2/c1-20-6-5-12(10-20)8-14(21)19-9-11-3-2-4-13(7-11)22-15(16,17)18/h2-7,10H,8-9H2,1H3,(H,19,21) |
| InChIKey | KEDUARPKMBQXQJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |