C9H9F3N2O2 — CID 142471729
2-[3-(trifluoromethoxy)phenyl]acetohydrazide (PubChem CID 142471729) has the molecular formula C9H9F3N2O2 and a molecular weight of 234.18 g/mol. Its IUPAC name is 2-[3-(trifluoromethoxy)phenyl]acetohydrazide.
| Compound Name | 2-[3-(trifluoromethoxy)phenyl]acetohydrazide |
|---|---|
| PubChem CID | 142471729 |
| Molecular Formula | C9H9F3N2O2 |
| Molecular Weight | 234.18 g/mol |
| Exact Mass | 234.06 |
| IUPAC Name | 2-[3-(trifluoromethoxy)phenyl]acetohydrazide |
| SMILES | NNC(=O)Cc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C9H9F3N2O2/c10-9(11,12)16-7-3-1-2-6(4-7)5-8(15)14-13/h1-4H,5,13H2,(H,14,15) |
| InChIKey | BDNPVOHOJVSBJW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|