C14H16F3NO3 — CID 99850234
N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-2-[3-(trifluoromethoxy)phenyl]acetamide (PubChem CID 99850234) has the molecular formula C14H16F3NO3 and a molecular weight of 303.28 g/mol. Its IUPAC name is N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-2-[3-(trifluoromethoxy)phenyl]acetamide.
| Compound Name | N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 99850234 |
| Molecular Formula | C14H16F3NO3 |
| Molecular Weight | 303.28 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | N-[(2S)-2-cyclopropyl-2-hydroxyethyl]-2-[3-(trifluoromethoxy)phenyl]acetamide |
| SMILES | O=C(Cc1cccc(OC(F)(F)F)c1)NC[C@@H](O)C1CC1 |
| InChI | InChI=1S/C14H16F3NO3/c15-14(16,17)21-11-3-1-2-9(6-11)7-13(20)18-8-12(19)10-4-5-10/h1-3,6,10,12,19H,4-5,7-8H2,(H,18,20)/t12-/m1/s1 |
| InChIKey | RXUTYURRZWALAC-GFCCVEGCSA-N |
| XLogP | 2.01 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.28 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |