C15H16F3N3O4 — CID 74246446
2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide (PubChem CID 74246446) has the molecular formula C15H16F3N3O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide.
| Compound Name | 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 74246446 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 2-(1,3-dimethyl-2,5-dioxoimidazolidin-4-yl)-N-[[3-(trifluoromethoxy)phenyl]methyl]acetamide |
| SMILES | CN1C(=O)C(CC(=O)NCc2cccc(OC(F)(F)F)c2)N(C)C1=O |
| InChI | InChI=1S/C15H16F3N3O4/c1-20-11(13(23)21(2)14(20)24)7-12(22)19-8-9-4-3-5-10(6-9)25-15(16,17)18/h3-6,11H,7-8H2,1-2H3,(H,19,22) |
| InChIKey | LAOOKZAEKBMUAS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|