C21H23N3O4 — CID 97156727
2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenoxyphenyl)ethyl]acetamide (PubChem CID 97156727) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenoxyphenyl)ethyl]acetamide.
| Compound Name | 2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenoxyphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 97156727 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[(4R)-1,3-dimethyl-2,5-dioxoimidazolidin-4-yl]-N-[2-(3-phenoxyphenyl)ethyl]acetamide |
| SMILES | CN1C(=O)[C@@H](CC(=O)NCCc2cccc(Oc3ccccc3)c2)N(C)C1=O |
| InChI | InChI=1S/C21H23N3O4/c1-23-18(20(26)24(2)21(23)27)14-19(25)22-12-11-15-7-6-10-17(13-15)28-16-8-4-3-5-9-16/h3-10,13,18H,11-12,14H2,1-2H3,(H,22,25)/t18-/m1/s1 |
| InChIKey | VPQFHBYQGPXONJ-GOSISDBHSA-N |
| XLogP | 2.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|