C19H21F3N2O2 — CID 3818160
1-(2,6-diethylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea (PubChem CID 3818160) has the molecular formula C19H21F3N2O2 and a molecular weight of 366.38 g/mol. Its IUPAC name is 1-(2,6-diethylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea.
| Compound Name | 1-(2,6-diethylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea |
|---|---|
| PubChem CID | 3818160 |
| Molecular Formula | C19H21F3N2O2 |
| Molecular Weight | 366.38 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 1-(2,6-diethylphenyl)-3-[[3-(trifluoromethoxy)phenyl]methyl]urea |
| SMILES | CCc1cccc(CC)c1NC(=O)NCc1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C19H21F3N2O2/c1-3-14-8-6-9-15(4-2)17(14)24-18(25)23-12-13-7-5-10-16(11-13)26-19(20,21)22/h5-11H,3-4,12H2,1-2H3,(H2,23,24,25) |
| InChIKey | IVZNGTXVOSFBMC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.38 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |