C20H25F3N2O7S — CID 87783108
(3S)-3-[3-cyclohexylpropanoyl-[[3-(trifluoromethoxy)phenyl]sulfonylamino]amino]-4-oxobutanoic acid (PubChem CID 87783108) has the molecular formula C20H25F3N2O7S and a molecular weight of 494.49 g/mol. Its IUPAC name is (3S)-3-[3-cyclohexylpropanoyl-[[3-(trifluoromethoxy)phenyl]sulfonylamino]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-3-[3-cyclohexylpropanoyl-[[3-(trifluoromethoxy)phenyl]sulfonylamino]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 87783108 |
| Molecular Formula | C20H25F3N2O7S |
| Molecular Weight | 494.49 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | (3S)-3-[3-cyclohexylpropanoyl-[[3-(trifluoromethoxy)phenyl]sulfonylamino]amino]-4-oxobutanoic acid |
| SMILES | O=C[C@H](CC(=O)O)N(NS(=O)(=O)c1cccc(OC(F)(F)F)c1)C(=O)CCC1CCCCC1 |
| InChI | InChI=1S/C20H25F3N2O7S/c21-20(22,23)32-16-7-4-8-17(12-16)33(30,31)24-25(15(13-26)11-19(28)29)18(27)10-9-14-5-2-1-3-6-14/h4,7-8,12-15,24H,1-3,5-6,9-11H2,(H,28,29)/t15-/m0/s1 |
| InChIKey | ZTWSSBGKKTYKBP-HNNXBMFYSA-N |
| XLogP | 3.01 |
| TPSA | 130.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|