C13H17F3N2O3S — CID 119981759
N-(1-amino-2-cyclopropylpropan-2-yl)-3-(trifluoromethoxy)benzenesulfonamide (PubChem CID 119981759) has the molecular formula C13H17F3N2O3S and a molecular weight of 338.35 g/mol. Its IUPAC name is N-(1-amino-2-cyclopropylpropan-2-yl)-3-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-(1-amino-2-cyclopropylpropan-2-yl)-3-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 119981759 |
| Molecular Formula | C13H17F3N2O3S |
| Molecular Weight | 338.35 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-(1-amino-2-cyclopropylpropan-2-yl)-3-(trifluoromethoxy)benzenesulfonamide |
| SMILES | CC(CN)(NS(=O)(=O)c1cccc(OC(F)(F)F)c1)C1CC1 |
| InChI | InChI=1S/C13H17F3N2O3S/c1-12(8-17,9-5-6-9)18-22(19,20)11-4-2-3-10(7-11)21-13(14,15)16/h2-4,7,9,18H,5-6,8,17H2,1H3 |
| InChIKey | FPXULIGQUJJLMI-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |