C24H29FN2O2 — CID 42706792
N-[3-[N-(3-cyclopentylpropanoyl)anilino]propyl]-3-fluorobenzamide (PubChem CID 42706792) has the molecular formula C24H29FN2O2 and a molecular weight of 396.51 g/mol. Its IUPAC name is N-[3-[N-(3-cyclopentylpropanoyl)anilino]propyl]-3-fluorobenzamide.
| Compound Name | N-[3-[N-(3-cyclopentylpropanoyl)anilino]propyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 42706792 |
| Molecular Formula | C24H29FN2O2 |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[3-[N-(3-cyclopentylpropanoyl)anilino]propyl]-3-fluorobenzamide |
| SMILES | O=C(NCCCN(C(=O)CCC1CCCC1)c1ccccc1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H29FN2O2/c25-21-11-6-10-20(18-21)24(29)26-16-7-17-27(22-12-2-1-3-13-22)23(28)15-14-19-8-4-5-9-19/h1-3,6,10-13,18-19H,4-5,7-9,14-17H2,(H,26,29) |
| InChIKey | ICWVOIGXPDEDSH-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|