C21H33ClN2O2S — CID 14580305
(4-pentylcyclohexyl)methyl 3-(methylamino)-2-pyridin-2-yl-3-sulfanylidenepropanoate;hydrochloride (PubChem CID 14580305) has the molecular formula C21H33ClN2O2S and a molecular weight of 413.03 g/mol. Its IUPAC name is (4-pentylcyclohexyl)methyl 3-(methylamino)-2-pyridin-2-yl-3-sulfanylidenepropanoate;hydrochloride.
| Compound Name | (4-pentylcyclohexyl)methyl 3-(methylamino)-2-pyridin-2-yl-3-sulfanylidenepropanoate;hydrochloride |
|---|---|
| PubChem CID | 14580305 |
| Molecular Formula | C21H33ClN2O2S |
| Molecular Weight | 413.03 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | (4-pentylcyclohexyl)methyl 3-(methylamino)-2-pyridin-2-yl-3-sulfanylidenepropanoate;hydrochloride |
| SMILES | CCCCCC1CCC(COC(=O)C(C(=S)NC)c2ccccn2)CC1.Cl |
| InChI | InChI=1S/C21H32N2O2S.ClH/c1-3-4-5-8-16-10-12-17(13-11-16)15-25-21(24)19(20(26)22-2)18-9-6-7-14-23-18;/h6-7,9,14,16-17,19H,3-5,8,10-13,15H2,1-2H3,(H,22,26);1H |
| InChIKey | ZSNLMDKXIYXTOH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.03 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|