C17H17NO5S — CID 70866426
[4-(3-ethoxy-3-oxo-2-pyridin-2-ylpropanoyl)phenyl]methanesulfinic acid (PubChem CID 70866426) has the molecular formula C17H17NO5S and a molecular weight of 347.39 g/mol. Its IUPAC name is [4-(3-ethoxy-3-oxo-2-pyridin-2-ylpropanoyl)phenyl]methanesulfinic acid.
| Compound Name | [4-(3-ethoxy-3-oxo-2-pyridin-2-ylpropanoyl)phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 70866426 |
| Molecular Formula | C17H17NO5S |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [4-(3-ethoxy-3-oxo-2-pyridin-2-ylpropanoyl)phenyl]methanesulfinic acid |
| SMILES | CCOC(=O)C(C(=O)c1ccc(CS(=O)O)cc1)c1ccccn1 |
| InChI | InChI=1S/C17H17NO5S/c1-2-23-17(20)15(14-5-3-4-10-18-14)16(19)13-8-6-12(7-9-13)11-24(21)22/h3-10,15H,2,11H2,1H3,(H,21,22) |
| InChIKey | VRWWGPOFGQKXFO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 93.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|