C19H20O6S — CID 70866337
[4-[3-ethoxy-2-(4-methoxyphenyl)-3-oxopropanoyl]phenyl]methanesulfinic acid (PubChem CID 70866337) has the molecular formula C19H20O6S and a molecular weight of 376.43 g/mol. Its IUPAC name is [4-[3-ethoxy-2-(4-methoxyphenyl)-3-oxopropanoyl]phenyl]methanesulfinic acid.
| Compound Name | [4-[3-ethoxy-2-(4-methoxyphenyl)-3-oxopropanoyl]phenyl]methanesulfinic acid |
|---|---|
| PubChem CID | 70866337 |
| Molecular Formula | C19H20O6S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | [4-[3-ethoxy-2-(4-methoxyphenyl)-3-oxopropanoyl]phenyl]methanesulfinic acid |
| SMILES | CCOC(=O)C(C(=O)c1ccc(CS(=O)O)cc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C19H20O6S/c1-3-25-19(21)17(14-8-10-16(24-2)11-9-14)18(20)15-6-4-13(5-7-15)12-26(22)23/h4-11,17H,3,12H2,1-2H3,(H,22,23) |
| InChIKey | ITXCTMNJELYGRV-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|