C18H16F2O4 — CID 59431181
ethyl 3-(3,4-difluorophenyl)-2-(4-methoxyphenyl)-3-oxopropanoate (PubChem CID 59431181) has the molecular formula C18H16F2O4 and a molecular weight of 334.32 g/mol. Its IUPAC name is ethyl 3-(3,4-difluorophenyl)-2-(4-methoxyphenyl)-3-oxopropanoate.
| Compound Name | ethyl 3-(3,4-difluorophenyl)-2-(4-methoxyphenyl)-3-oxopropanoate |
|---|---|
| PubChem CID | 59431181 |
| Molecular Formula | C18H16F2O4 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | ethyl 3-(3,4-difluorophenyl)-2-(4-methoxyphenyl)-3-oxopropanoate |
| SMILES | CCOC(=O)C(C(=O)c1ccc(F)c(F)c1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C18H16F2O4/c1-3-24-18(22)16(11-4-7-13(23-2)8-5-11)17(21)12-6-9-14(19)15(20)10-12/h4-10,16H,3H2,1-2H3 |
| InChIKey | WDLIELJPNQVDMO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|