C15H10F4O — CID 139790694
4-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-1,2-difluorobenzene (PubChem CID 139790694) has the molecular formula C15H10F4O and a molecular weight of 282.24 g/mol. Its IUPAC name is 4-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-1,2-difluorobenzene.
| Compound Name | 4-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-1,2-difluorobenzene |
|---|---|
| PubChem CID | 139790694 |
| Molecular Formula | C15H10F4O |
| Molecular Weight | 282.24 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 4-[(E)-1,2-difluoro-2-(4-methoxyphenyl)ethenyl]-1,2-difluorobenzene |
| SMILES | COc1ccc(/C(F)=C(\F)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C15H10F4O/c1-20-11-5-2-9(3-6-11)14(18)15(19)10-4-7-12(16)13(17)8-10/h2-8H,1H3/b15-14+ |
| InChIKey | YNBGBTPCUYRHTE-CCEZHUSRSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.24 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|