About CID 12714057
CID 12714057 (PubChem CID 12714057) has the molecular formula C15H15O3
and a molecular weight of 243.28 g/mol.
Molecular Properties
| Compound Name | CID 12714057 |
| PubChem CID | 12714057 |
| Molecular Formula | C15H15O3 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | — |
| SMILES | COc1ccc([C](O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C15H15O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,16H,1-2H3 |
| InChIKey | IKXQOXGFLNCCRO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 12714057 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12714057?
The IUPAC name of CID 12714057 (CID 12714057) is not available.
What is the SMILES notation for CID 12714057?
The canonical SMILES for CID 12714057 is COc1ccc([C](O)c2ccc(OC)cc2)cc1.
What is the InChIKey of CID 12714057?
The InChIKey is IKXQOXGFLNCCRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15O3/c1-17-13-7-3-11(4-8-13)15(16)12-5-9-14(18-2)10-6-12/h3-10,16H,1-2H3.
What are the key properties of CID 12714057?
CID 12714057 has a molecular weight of 243.28 g/mol, XLogP of 3.00, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12714057 is sourced from PubChem (CID 12714057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).