C11H14O2S2 — CID 10444427
1-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethenol (PubChem CID 10444427) has the molecular formula C11H14O2S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethenol.
| Compound Name | 1-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethenol |
|---|---|
| PubChem CID | 10444427 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1-(4-methoxyphenyl)-2,2-bis(methylsulfanyl)ethenol |
| SMILES | COc1ccc(C(O)=C(SC)SC)cc1 |
| InChI | InChI=1S/C11H14O2S2/c1-13-9-6-4-8(5-7-9)10(12)11(14-2)15-3/h4-7,12H,1-3H3 |
| InChIKey | DDKMINMYBIPOOA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|